C10H19ClN2 — CID 103441569
[1-[(E)-3-chloroprop-2-enyl]-4-methylpiperidin-2-yl]methanamine (PubChem CID 103441569) has the molecular formula C10H19ClN2 and a molecular weight of 202.73 g/mol. Its IUPAC name is [1-[(E)-3-chloroprop-2-enyl]-4-methylpiperidin-2-yl]methanamine.
| Compound Name | [1-[(E)-3-chloroprop-2-enyl]-4-methylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 103441569 |
| Molecular Formula | C10H19ClN2 |
| Molecular Weight | 202.73 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [1-[(E)-3-chloroprop-2-enyl]-4-methylpiperidin-2-yl]methanamine |
| SMILES | CC1CCN(C/C=C/Cl)C(CN)C1 |
| InChI | InChI=1S/C10H19ClN2/c1-9-3-6-13(5-2-4-11)10(7-9)8-12/h2,4,9-10H,3,5-8,12H2,1H3/b4-2+ |
| InChIKey | AVOLQEHDSVUESQ-DUXPYHPUSA-N |
| XLogP | 1.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |