C9H17ClN2 — CID 76919196
[1-(3-chloroprop-2-enyl)piperidin-2-yl]methanamine (PubChem CID 76919196) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is [1-(3-chloroprop-2-enyl)piperidin-2-yl]methanamine.
| Compound Name | [1-(3-chloroprop-2-enyl)piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 76919196 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | [1-(3-chloroprop-2-enyl)piperidin-2-yl]methanamine |
| SMILES | NCC1CCCCN1CC=CCl |
| InChI | InChI=1S/C9H17ClN2/c10-5-3-7-12-6-2-1-4-9(12)8-11/h3,5,9H,1-2,4,6-8,11H2 |
| InChIKey | JLDVLNJSCPITNN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |