C10H16ClNO2 — CID 77047205
1-(3-chloroprop-2-enyl)azepane-2-carboxylic acid (PubChem CID 77047205) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is 1-(3-chloroprop-2-enyl)azepane-2-carboxylic acid.
| Compound Name | 1-(3-chloroprop-2-enyl)azepane-2-carboxylic acid |
|---|---|
| PubChem CID | 77047205 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 1-(3-chloroprop-2-enyl)azepane-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCCN1CC=CCl |
| InChI | InChI=1S/C10H16ClNO2/c11-6-4-8-12-7-3-1-2-5-9(12)10(13)14/h4,6,9H,1-3,5,7-8H2,(H,13,14) |
| InChIKey | OCVRWAGDCHITBM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |