C10H16F3NO3 — CID 64562379
1-(3,3,3-trifluoro-2-hydroxypropyl)azepane-2-carboxylic acid (PubChem CID 64562379) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-(3,3,3-trifluoro-2-hydroxypropyl)azepane-2-carboxylic acid.
| Compound Name | 1-(3,3,3-trifluoro-2-hydroxypropyl)azepane-2-carboxylic acid |
|---|---|
| PubChem CID | 64562379 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(3,3,3-trifluoro-2-hydroxypropyl)azepane-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCCN1CC(O)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3/c11-10(12,13)8(15)6-14-5-3-1-2-4-7(14)9(16)17/h7-8,15H,1-6H2,(H,16,17) |
| InChIKey | LHBKPSSAOGOBRN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |