C14H17NO2 — CID 43442189
1-[(E)-3-phenylprop-2-enyl]pyrrolidine-2-carboxylic acid (PubChem CID 43442189) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-[(E)-3-phenylprop-2-enyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(E)-3-phenylprop-2-enyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43442189 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-[(E)-3-phenylprop-2-enyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H17NO2/c16-14(17)13-9-5-11-15(13)10-4-8-12-6-2-1-3-7-12/h1-4,6-8,13H,5,9-11H2,(H,16,17)/b8-4+ |
| InChIKey | HTWLNYVLGOGDES-XBXARRHUSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |