C21H24ClNO2 — CID 11717409
(2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylic acid;hydrochloride (PubChem CID 11717409) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 11717409 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2R)-1-(4,4-diphenylbut-3-enyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@H]1CCCN1CCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2.ClH/c23-21(24)20-14-8-16-22(20)15-7-13-19(17-9-3-1-4-10-17)18-11-5-2-6-12-18;/h1-6,9-13,20H,7-8,14-16H2,(H,23,24);1H/t20-;/m1./s1 |
| InChIKey | KLAMBPASJOYHOM-VEIFNGETSA-N |
| XLogP | 4.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |