C21H23NO2 — CID 59941159
methyl (2S)-1-(4,4-diphenylbut-3-enyl)azetidine-2-carboxylate (PubChem CID 59941159) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl (2S)-1-(4,4-diphenylbut-3-enyl)azetidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(4,4-diphenylbut-3-enyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 59941159 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl (2S)-1-(4,4-diphenylbut-3-enyl)azetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCN1CCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-24-21(23)20-14-16-22(20)15-8-13-19(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-7,9-13,20H,8,14-16H2,1H3/t20-/m0/s1 |
| InChIKey | QIRNSROFSPZMBK-FQEVSTJZSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |