C30H52N4O8 — CID 138991676
(2S)-1-[5-[(2S)-2-carboxypyrrolidin-1-yl]pentyl]pyrrolidine-2-carboxylic acid (PubChem CID 138991676) has the molecular formula C30H52N4O8 and a molecular weight of 596.77 g/mol. Its IUPAC name is (2S)-1-[5-[(2S)-2-carboxypyrrolidin-1-yl]pentyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[5-[(2S)-2-carboxypyrrolidin-1-yl]pentyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138991676 |
| Molecular Formula | C30H52N4O8 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.38 |
| IUPAC Name | (2S)-1-[5-[(2S)-2-carboxypyrrolidin-1-yl]pentyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1CCCCCN1CCC[C@H]1C(=O)O.O=C(O)[C@@H]1CCCN1CCCCCN1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/2C15H26N2O4/c2*18-14(19)12-6-4-10-16(12)8-2-1-3-9-17-11-5-7-13(17)15(20)21/h2*12-13H,1-11H2,(H,18,19)(H,20,21)/t2*12-,13-/m00/s1 |
| InChIKey | ZNRRFAKBVSHILY-PNWPTSOWSA-N |
| XLogP | 2.51 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|