C20H32N2O6 — CID 90757366
(2R)-1-[10-[(2R)-2-carboxypyrrolidin-1-yl]-9,10-dioxodecyl]pyrrolidine-2-carboxylic acid (PubChem CID 90757366) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is (2R)-1-[10-[(2R)-2-carboxypyrrolidin-1-yl]-9,10-dioxodecyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[10-[(2R)-2-carboxypyrrolidin-1-yl]-9,10-dioxodecyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90757366 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2R)-1-[10-[(2R)-2-carboxypyrrolidin-1-yl]-9,10-dioxodecyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(CCCCCCCCN1CCC[C@@H]1C(=O)O)C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C20H32N2O6/c23-17(18(24)22-14-8-10-16(22)20(27)28)11-5-3-1-2-4-6-12-21-13-7-9-15(21)19(25)26/h15-16H,1-14H2,(H,25,26)(H,27,28)/t15-,16-/m1/s1 |
| InChIKey | OFROVARVCFAZJV-HZPDHXFCSA-N |
| XLogP | 1.91 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|