C17H23N — CID 71379396
1-(3-phenylprop-2-enyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 71379396) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-(3-phenylprop-2-enyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(3-phenylprop-2-enyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 71379396 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-(3-phenylprop-2-enyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | C(=Cc1ccccc1)CN1CCC2CCCCC21 |
| InChI | InChI=1S/C17H23N/c1-2-7-15(8-3-1)9-6-13-18-14-12-16-10-4-5-11-17(16)18/h1-3,6-9,16-17H,4-5,10-14H2 |
| InChIKey | REZYBZOBKCVCFU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |