C17H24BrN — CID 82750262
1-(3-bromo-2-phenylpropyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 82750262) has the molecular formula C17H24BrN and a molecular weight of 322.29 g/mol. Its IUPAC name is 1-(3-bromo-2-phenylpropyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(3-bromo-2-phenylpropyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 82750262 |
| Molecular Formula | C17H24BrN |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(3-bromo-2-phenylpropyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | BrCC(CN1CCC2CCCCC21)c1ccccc1 |
| InChI | InChI=1S/C17H24BrN/c18-12-16(14-6-2-1-3-7-14)13-19-11-10-15-8-4-5-9-17(15)19/h1-3,6-7,15-17H,4-5,8-13H2 |
| InChIKey | NVPZQJQTZZQFFW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|