C14H22N2S — CID 82751042
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-thiophen-2-ylethanamine (PubChem CID 82751042) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-thiophen-2-ylethanamine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 82751042 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-thiophen-2-ylethanamine |
| SMILES | NC(CN1CCC2CCCCC21)c1cccs1 |
| InChI | InChI=1S/C14H22N2S/c15-12(14-6-3-9-17-14)10-16-8-7-11-4-1-2-5-13(11)16/h3,6,9,11-13H,1-2,4-5,7-8,10,15H2 |
| InChIKey | YGEKNMYDLBEKSG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |