C16H24N2 — CID 82750298
N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]aniline (PubChem CID 82750298) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]aniline.
| Compound Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82750298 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]aniline |
| SMILES | c1ccc(NCCN2CCC3CCCCC32)cc1 |
| InChI | InChI=1S/C16H24N2/c1-2-7-15(8-3-1)17-11-13-18-12-10-14-6-4-5-9-16(14)18/h1-3,7-8,14,16-17H,4-6,9-13H2 |
| InChIKey | BLWYARRDZVTRPX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |