C16H23BrN2 — CID 82752272
N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]-2-bromoaniline (PubChem CID 82752272) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]-2-bromoaniline.
| Compound Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]-2-bromoaniline |
|---|---|
| PubChem CID | 82752272 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)ethyl]-2-bromoaniline |
| SMILES | Brc1ccccc1NCCN1CCC2CCCCC21 |
| InChI | InChI=1S/C16H23BrN2/c17-14-6-2-3-7-15(14)18-10-12-19-11-9-13-5-1-4-8-16(13)19/h2-3,6-7,13,16,18H,1,4-5,8-12H2 |
| InChIKey | GBAYDZBZSDYMGX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |