C12H22N2 — CID 131245397
(E)-4-[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]but-2-en-1-amine (PubChem CID 131245397) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (E)-4-[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]but-2-en-1-amine.
| Compound Name | (E)-4-[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]but-2-en-1-amine |
|---|---|
| PubChem CID | 131245397 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (E)-4-[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]but-2-en-1-amine |
| SMILES | NC/C=C/CN1CC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C12H22N2/c13-8-3-4-9-14-10-7-11-5-1-2-6-12(11)14/h3-4,11-12H,1-2,5-10,13H2/b4-3+/t11-,12-/m0/s1 |
| InChIKey | LQTZCQQXAXAEQG-QSKOYVBTSA-N |
| XLogP | 1.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|