C13H22ClN — CID 77051233
1-(4-chlorobut-2-enyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 77051233) has the molecular formula C13H22ClN and a molecular weight of 227.78 g/mol. Its IUPAC name is 1-(4-chlorobut-2-enyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(4-chlorobut-2-enyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 77051233 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.78 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 1-(4-chlorobut-2-enyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | ClCC=CCN1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H22ClN/c14-9-3-4-10-15-11-5-7-12-6-1-2-8-13(12)15/h3-4,12-13H,1-2,5-11H2 |
| InChIKey | ZIVICSPMYLTLEK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|