C11H20ClNO — CID 112561733
1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chloropropan-2-ol (PubChem CID 112561733) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chloropropan-2-ol.
| Compound Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 112561733 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-3-chloropropan-2-ol |
| SMILES | OC(CCl)CN1CCCC2CCCC21 |
| InChI | InChI=1S/C11H20ClNO/c12-7-10(14)8-13-6-2-4-9-3-1-5-11(9)13/h9-11,14H,1-8H2 |
| InChIKey | GIPFFMZLZQBAMA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|