C14H27NO — CID 106802440
6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)hexan-3-ol (PubChem CID 106802440) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)hexan-3-ol.
| Compound Name | 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)hexan-3-ol |
|---|---|
| PubChem CID | 106802440 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 6-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)hexan-3-ol |
| SMILES | CCC(O)CCCN1CCCC2CCCC21 |
| InChI | InChI=1S/C14H27NO/c1-2-13(16)8-5-11-15-10-4-7-12-6-3-9-14(12)15/h12-14,16H,2-11H2,1H3 |
| InChIKey | OODTXHBWZBBNHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |