C15H27NO — CID 106801610
6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexan-3-one (PubChem CID 106801610) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexan-3-one.
| Compound Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexan-3-one |
|---|---|
| PubChem CID | 106801610 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexan-3-one |
| SMILES | CCC(=O)CCCN1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H27NO/c1-2-14(17)9-6-12-16-11-5-8-13-7-3-4-10-15(13)16/h13,15H,2-12H2,1H3/t13-,15-/m1/s1 |
| InChIKey | DVQUZOQSXPALTE-UKRRQHHQSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |