C15H29NS — CID 102729068
6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexane-1-thiol (PubChem CID 102729068) has the molecular formula C15H29NS and a molecular weight of 255.47 g/mol. Its IUPAC name is 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexane-1-thiol.
| Compound Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexane-1-thiol |
|---|---|
| PubChem CID | 102729068 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 6-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]hexane-1-thiol |
| SMILES | SCCCCCCN1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H29NS/c17-13-6-2-1-5-11-16-12-7-9-14-8-3-4-10-15(14)16/h14-15,17H,1-13H2/t14-,15-/m1/s1 |
| InChIKey | SGEQZYBKBVTEJI-HUUCEWRRSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|