C14H23N — CID 115872657
1-pent-4-ynyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 115872657) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-pent-4-ynyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-pent-4-ynyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 115872657 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-pent-4-ynyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | C#CCCCN1CCCC2CCCCC21 |
| InChI | InChI=1S/C14H23N/c1-2-3-6-11-15-12-7-9-13-8-4-5-10-14(13)15/h1,13-14H,3-12H2 |
| InChIKey | JFNQCZGVSVMYQJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|