C11H20BrN — CID 82749789
1-(3-bromopropyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 82749789) has the molecular formula C11H20BrN and a molecular weight of 246.19 g/mol. Its IUPAC name is 1-(3-bromopropyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-(3-bromopropyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 82749789 |
| Molecular Formula | C11H20BrN |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(3-bromopropyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | BrCCCN1CCC2CCCCC21 |
| InChI | InChI=1S/C11H20BrN/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h10-11H,1-9H2 |
| InChIKey | WNSXKXIEGKDZIE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|