C13H25N3O — CID 82750587
5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N'-hydroxypentanimidamide (PubChem CID 82750587) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N'-hydroxypentanimidamide.
| Compound Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 82750587 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N'-hydroxypentanimidamide |
| SMILES | NC(CCCCN1CCC2CCCCC21)=NO |
| InChI | InChI=1S/C13H25N3O/c14-13(15-17)7-3-4-9-16-10-8-11-5-1-2-6-12(11)16/h11-12,17H,1-10H2,(H2,14,15) |
| InChIKey | BFKHGTPBHGWBLJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|