C12H22N2O2 — CID 82750702
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid (PubChem CID 82750702) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid |
|---|---|
| PubChem CID | 82750702 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid |
| SMILES | NC(CCN1CCC2CCCCC21)C(=O)O |
| InChI | InChI=1S/C12H22N2O2/c13-10(12(15)16)6-8-14-7-5-9-3-1-2-4-11(9)14/h9-11H,1-8,13H2,(H,15,16) |
| InChIKey | MTLFCXTYWTWYHW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |