4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid

C12H22N2O2 — CID 82750702

IUPAC4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid
SMILESNC(CCN1CCC2CCCCC21)C(=O)O
InChIInChI=1S/C12H22N2O2/c13-10(12(15)16)6-8-14-7-5-9-3-1-2-4-11(9)14/h9-11H,1-8,13H2,(H,15,16)
InChIKeyMTLFCXTYWTWYHW-UHFFFAOYSA-N
MW226.32 g/mol
LogP1.05
Rot. Bonds4

About 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid

4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid (PubChem CID 82750702) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid.

Molecular Properties

Compound Name4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid
PubChem CID82750702
Molecular FormulaC12H22N2O2
Molecular Weight226.32 g/mol
Exact Mass226.17
IUPAC Name4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid
SMILESNC(CCN1CCC2CCCCC21)C(=O)O
InChIInChI=1S/C12H22N2O2/c13-10(12(15)16)6-8-14-7-5-9-3-1-2-4-11(9)14/h9-11H,1-8,13H2,(H,15,16)
InChIKeyMTLFCXTYWTWYHW-UHFFFAOYSA-N
XLogP1.05
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid?
The IUPAC name of 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid (CID 82750702) is 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid.
What is the SMILES notation for 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid?
The canonical SMILES for 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid is NC(CCN1CCC2CCCCC21)C(=O)O.
What is the InChIKey of 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid?
The InChIKey is MTLFCXTYWTWYHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c13-10(12(15)16)6-8-14-7-5-9-3-1-2-4-11(9)14/h9-11H,1-8,13H2,(H,15,16).
What are the key properties of 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid?
4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid has a molecular weight of 226.32 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminobutanoic acid is sourced from PubChem (CID 82750702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).