C11H22N2O2 — CID 63028622
2-amino-4-(2-ethylpiperidin-1-yl)butanoic acid (PubChem CID 63028622) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-4-(2-ethylpiperidin-1-yl)butanoic acid.
| Compound Name | 2-amino-4-(2-ethylpiperidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 63028622 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-amino-4-(2-ethylpiperidin-1-yl)butanoic acid |
| SMILES | CCC1CCCCN1CCC(N)C(=O)O |
| InChI | InChI=1S/C11H22N2O2/c1-2-9-5-3-4-7-13(9)8-6-10(12)11(14)15/h9-10H,2-8,12H2,1H3,(H,14,15) |
| InChIKey | FTJUTGCFWDPNRZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |