C13H24N2O2 — CID 82749801
ethyl 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminopropanoate (PubChem CID 82749801) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is ethyl 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminopropanoate.
| Compound Name | ethyl 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminopropanoate |
|---|---|
| PubChem CID | 82749801 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | ethyl 3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-aminopropanoate |
| SMILES | CCOC(=O)C(N)CN1CCC2CCCCC21 |
| InChI | InChI=1S/C13H24N2O2/c1-2-17-13(16)11(14)9-15-8-7-10-5-3-4-6-12(10)15/h10-12H,2-9,14H2,1H3 |
| InChIKey | HFLUUAGEMQOMRW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |