C22H43N4O4+ — CID 163179955
(2S)-2-amino-6-[3-[(2R)-1-[(5S)-5-amino-5-carboxypentyl]piperidin-2-yl]piperidin-1-ium-1-yl]hexanoic acid (PubChem CID 163179955) has the molecular formula C22H43N4O4+ and a molecular weight of 427.61 g/mol. Its IUPAC name is (2S)-2-amino-6-[3-[(2R)-1-[(5S)-5-amino-5-carboxypentyl]piperidin-2-yl]piperidin-1-ium-1-yl]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[3-[(2R)-1-[(5S)-5-amino-5-carboxypentyl]piperidin-2-yl]piperidin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 163179955 |
| Molecular Formula | C22H43N4O4+ |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | (2S)-2-amino-6-[3-[(2R)-1-[(5S)-5-amino-5-carboxypentyl]piperidin-2-yl]piperidin-1-ium-1-yl]hexanoic acid |
| SMILES | N[C@@H](CCCCN1CCCC[C@@H]1C1CCC[NH+](CCCC[C@H](N)C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C22H42N4O4/c23-18(21(27)28)9-1-4-12-25-13-7-8-17(16-25)20-11-3-6-15-26(20)14-5-2-10-19(24)22(29)30/h17-20H,1-16,23-24H2,(H,27,28)(H,29,30)/p+1/t17?,18-,19-,20+/m0/s1 |
| InChIKey | OHAQOCFJURSCMK-SEBOWIOWSA-O |
| XLogP | 0.30 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|