C14H27N3O4 — CID 70226223
(2S)-2,6-diaminohexanoic acid;(2S)-1-prop-2-enylpyrrolidine-2-carboxylic acid (PubChem CID 70226223) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;(2S)-1-prop-2-enylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;(2S)-1-prop-2-enylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70226223 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;(2S)-1-prop-2-enylpyrrolidine-2-carboxylic acid |
| SMILES | C=CCN1CCC[C@H]1C(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H13NO2.C6H14N2O2/c1-2-5-9-6-3-4-7(9)8(10)11;7-4-2-1-3-5(8)6(9)10/h2,7H,1,3-6H2,(H,10,11);5H,1-4,7-8H2,(H,9,10)/t7-;5-/m00/s1 |
| InChIKey | QQWWUIFXNIGLBK-SJEAMFKXSA-N |
| XLogP | 0.25 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|