C11H21NO — CID 130723594
(3aR,7aR)-1-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 130723594) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (3aR,7aR)-1-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | (3aR,7aR)-1-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 130723594 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (3aR,7aR)-1-(2-methoxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | COCCN1CC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C11H21NO/c1-13-9-8-12-7-6-10-4-2-3-5-11(10)12/h10-11H,2-9H2,1H3/t10-,11-/m1/s1 |
| InChIKey | RWQGJPHORWGMFE-GHMZBOCLSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |