C15H28BrN — CID 65320287
1-[2-(bromomethyl)-3,3-dimethylbutyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine (PubChem CID 65320287) has the molecular formula C15H28BrN and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 65320287 |
| Molecular Formula | C15H28BrN |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
| SMILES | CC(C)(C)C(CBr)CN1CCCC2CCCC21 |
| InChI | InChI=1S/C15H28BrN/c1-15(2,3)13(10-16)11-17-9-5-7-12-6-4-8-14(12)17/h12-14H,4-11H2,1-3H3 |
| InChIKey | YFIVBUJMXOMKOF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|