C12H19BrF3N — CID 64758957
1-(2-bromo-3,3,3-trifluoropropyl)-2-cyclopentylpyrrolidine (PubChem CID 64758957) has the molecular formula C12H19BrF3N and a molecular weight of 314.19 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)-2-cyclopentylpyrrolidine.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)-2-cyclopentylpyrrolidine |
|---|---|
| PubChem CID | 64758957 |
| Molecular Formula | C12H19BrF3N |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)-2-cyclopentylpyrrolidine |
| SMILES | FC(F)(F)C(Br)CN1CCCC1C1CCCC1 |
| InChI | InChI=1S/C12H19BrF3N/c13-11(12(14,15)16)8-17-7-3-6-10(17)9-4-1-2-5-9/h9-11H,1-8H2 |
| InChIKey | DGCBGIYNQVMSFU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|