C10H17BrF3NO — CID 64758128
2-[1-(2-bromo-3,3,3-trifluoropropyl)piperidin-2-yl]ethanol (PubChem CID 64758128) has the molecular formula C10H17BrF3NO and a molecular weight of 304.15 g/mol. Its IUPAC name is 2-[1-(2-bromo-3,3,3-trifluoropropyl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(2-bromo-3,3,3-trifluoropropyl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 64758128 |
| Molecular Formula | C10H17BrF3NO |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[1-(2-bromo-3,3,3-trifluoropropyl)piperidin-2-yl]ethanol |
| SMILES | OCCC1CCCCN1CC(Br)C(F)(F)F |
| InChI | InChI=1S/C10H17BrF3NO/c11-9(10(12,13)14)7-15-5-2-1-3-8(15)4-6-16/h8-9,16H,1-7H2 |
| InChIKey | JUSIYXKMLLPLIL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|