C17H23NO2 — CID 172896636
[(4aS,6R,7aS)-4-[(E)-3-phenylprop-2-enyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol (PubChem CID 172896636) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(4aS,6R,7aS)-4-[(E)-3-phenylprop-2-enyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol.
| Compound Name | [(4aS,6R,7aS)-4-[(E)-3-phenylprop-2-enyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
|---|---|
| PubChem CID | 172896636 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(4aS,6R,7aS)-4-[(E)-3-phenylprop-2-enyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
| SMILES | OC[C@H]1C[C@@H]2OCCN(C/C=C/c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C17H23NO2/c19-13-15-11-16-17(12-15)20-10-9-18(16)8-4-7-14-5-2-1-3-6-14/h1-7,15-17,19H,8-13H2/b7-4+/t15-,16+,17+/m1/s1 |
| InChIKey | GGUMPPTUTOWDAD-CMHBCTHXSA-N |
| XLogP | 2.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |