C22H25NO4 — CID 154563997
[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 154563997) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is [(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 154563997 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | O=C(c1ccccc1OCc1ccccc1)N1CCOC2C[C@H](CO)C[C@@H]21 |
| InChI | InChI=1S/C22H25NO4/c24-14-17-12-19-21(13-17)26-11-10-23(19)22(25)18-8-4-5-9-20(18)27-15-16-6-2-1-3-7-16/h1-9,17,19,21,24H,10-15H2/t17-,19+,21?/m1/s1 |
| InChIKey | LXISKPDHNLDELX-VCPDFFEISA-N |
| XLogP | 2.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |