C17H20F3NO3 — CID 154567204
1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 154567204) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 154567204 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1ccccc1C(F)(F)F)N1CCOC2C[C@H](CO)C[C@@H]21 |
| InChI | InChI=1S/C17H20F3NO3/c18-17(19,20)13-4-2-1-3-12(13)9-16(23)21-5-6-24-15-8-11(10-22)7-14(15)21/h1-4,11,14-15,22H,5-10H2/t11-,14+,15?/m1/s1 |
| InChIKey | SJNKDDXKWHTZNL-IFVPNFOKSA-N |
| XLogP | 2.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |