C17H25N3O3 — CID 154568035
1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[methyl(pyridin-4-ylmethyl)amino]ethanone (PubChem CID 154568035) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[methyl(pyridin-4-ylmethyl)amino]ethanone.
| Compound Name | 1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[methyl(pyridin-4-ylmethyl)amino]ethanone |
|---|---|
| PubChem CID | 154568035 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-[(4aS,6R)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-[methyl(pyridin-4-ylmethyl)amino]ethanone |
| SMILES | CN(CC(=O)N1CCOC2C[C@H](CO)C[C@@H]21)Cc1ccncc1 |
| InChI | InChI=1S/C17H25N3O3/c1-19(10-13-2-4-18-5-3-13)11-17(22)20-6-7-23-16-9-14(12-21)8-15(16)20/h2-5,14-16,21H,6-12H2,1H3/t14-,15+,16?/m1/s1 |
| InChIKey | ULZNWHRVTISLHF-YSPPHNQVSA-N |
| XLogP | 0.51 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |