C17H22ClNO4 — CID 172897287
1-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(4-chloro-2-methylphenoxy)ethanone (PubChem CID 172897287) has the molecular formula C17H22ClNO4 and a molecular weight of 339.82 g/mol. Its IUPAC name is 1-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(4-chloro-2-methylphenoxy)ethanone.
| Compound Name | 1-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(4-chloro-2-methylphenoxy)ethanone |
|---|---|
| PubChem CID | 172897287 |
| Molecular Formula | C17H22ClNO4 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-2-(4-chloro-2-methylphenoxy)ethanone |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)N1CCO[C@H]2C[C@H](CO)C[C@@H]21 |
| InChI | InChI=1S/C17H22ClNO4/c1-11-6-13(18)2-3-15(11)23-10-17(21)19-4-5-22-16-8-12(9-20)7-14(16)19/h2-3,6,12,14,16,20H,4-5,7-10H2,1H3/t12-,14+,16+/m1/s1 |
| InChIKey | JDIHWQJYXCELLI-INWMFGNUSA-N |
| XLogP | 2.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |