C15H18ClNO5 — CID 125118700
2-[(2R)-4-[2-(4-chloro-2-methylphenoxy)acetyl]morpholin-2-yl]acetic acid (PubChem CID 125118700) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is 2-[(2R)-4-[2-(4-chloro-2-methylphenoxy)acetyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-4-[2-(4-chloro-2-methylphenoxy)acetyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 125118700 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[(2R)-4-[2-(4-chloro-2-methylphenoxy)acetyl]morpholin-2-yl]acetic acid |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)N1CCO[C@H](CC(=O)O)C1 |
| InChI | InChI=1S/C15H18ClNO5/c1-10-6-11(16)2-3-13(10)22-9-14(18)17-4-5-21-12(8-17)7-15(19)20/h2-3,6,12H,4-5,7-9H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | MBUSCOPTKZBHJS-GFCCVEGCSA-N |
| XLogP | 1.73 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |