C14H16Cl3NO3 — CID 55571550
1-(2-ethylmorpholin-4-yl)-2-(2,4,5-trichlorophenoxy)ethanone (PubChem CID 55571550) has the molecular formula C14H16Cl3NO3 and a molecular weight of 352.65 g/mol. Its IUPAC name is 1-(2-ethylmorpholin-4-yl)-2-(2,4,5-trichlorophenoxy)ethanone.
| Compound Name | 1-(2-ethylmorpholin-4-yl)-2-(2,4,5-trichlorophenoxy)ethanone |
|---|---|
| PubChem CID | 55571550 |
| Molecular Formula | C14H16Cl3NO3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 1-(2-ethylmorpholin-4-yl)-2-(2,4,5-trichlorophenoxy)ethanone |
| SMILES | CCC1CN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CCO1 |
| InChI | InChI=1S/C14H16Cl3NO3/c1-2-9-7-18(3-4-20-9)14(19)8-21-13-6-11(16)10(15)5-12(13)17/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | BZNAAPCRILJOHU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|