C14H15Cl2NO5S — CID 110308290
2-(2,5-dichlorophenoxy)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)ethanone (PubChem CID 110308290) has the molecular formula C14H15Cl2NO5S and a molecular weight of 380.25 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)ethanone.
| Compound Name | 2-(2,5-dichlorophenoxy)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)ethanone |
|---|---|
| PubChem CID | 110308290 |
| Molecular Formula | C14H15Cl2NO5S |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-1-(6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazin-4-yl)ethanone |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)N1CCOC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C14H15Cl2NO5S/c15-9-1-2-10(16)12(5-9)22-6-14(18)17-3-4-21-13-8-23(19,20)7-11(13)17/h1-2,5,11,13H,3-4,6-8H2 |
| InChIKey | VNSDPBXBZHBECZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |