C14H17Cl2FN2O3 — CID 120810504
1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-(2-chloro-4-fluorophenoxy)ethanone;hydrochloride (PubChem CID 120810504) has the molecular formula C14H17Cl2FN2O3 and a molecular weight of 351.21 g/mol. Its IUPAC name is 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-(2-chloro-4-fluorophenoxy)ethanone;hydrochloride.
| Compound Name | 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-(2-chloro-4-fluorophenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120810504 |
| Molecular Formula | C14H17Cl2FN2O3 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-(2-chloro-4-fluorophenoxy)ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1ccc(F)cc1Cl)N1CCO[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C14H16ClFN2O3.ClH/c15-10-5-9(16)1-2-12(10)21-8-14(19)18-3-4-20-13-7-17-6-11(13)18;/h1-2,5,11,13,17H,3-4,6-8H2;1H/t11-,13+;/m1./s1 |
| InChIKey | SRKJCELMMVYIDM-YLAFAASESA-N |
| XLogP | 1.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |