C8H16ClN3O2 — CID 130757963
1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-aminoethanone;hydrochloride (PubChem CID 130757963) has the molecular formula C8H16ClN3O2 and a molecular weight of 221.69 g/mol. Its IUPAC name is 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-aminoethanone;hydrochloride.
| Compound Name | 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-aminoethanone;hydrochloride |
|---|---|
| PubChem CID | 130757963 |
| Molecular Formula | C8H16ClN3O2 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-2-aminoethanone;hydrochloride |
| SMILES | Cl.NCC(=O)N1CCO[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C8H15N3O2.ClH/c9-3-8(12)11-1-2-13-7-5-10-4-6(7)11;/h6-7,10H,1-5,9H2;1H/t6-,7+;/m1./s1 |
| InChIKey | KJWJHFQPYCDOFD-HHQFNNIRSA-N |
| XLogP | -1.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |