C11H21ClN2O — CID 130670957
4-(3-methylcyclobutyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride (PubChem CID 130670957) has the molecular formula C11H21ClN2O and a molecular weight of 232.75 g/mol. Its IUPAC name is 4-(3-methylcyclobutyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride.
| Compound Name | 4-(3-methylcyclobutyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 130670957 |
| Molecular Formula | C11H21ClN2O |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-(3-methylcyclobutyl)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine;hydrochloride |
| SMILES | CC1CC(N2CCOC3CNCC32)C1.Cl |
| InChI | InChI=1S/C11H20N2O.ClH/c1-8-4-9(5-8)13-2-3-14-11-7-12-6-10(11)13;/h8-12H,2-7H2,1H3;1H |
| InChIKey | XWDNQXDUENTPNC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |