C15H20ClFN2O3 — CID 120810532
1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-3-(2-fluorophenoxy)propan-1-one;hydrochloride (PubChem CID 120810532) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-3-(2-fluorophenoxy)propan-1-one;hydrochloride.
| Compound Name | 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-3-(2-fluorophenoxy)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120810532 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[(4aR,7aS)-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-yl]-3-(2-fluorophenoxy)propan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCOc1ccccc1F)N1CCO[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C15H19FN2O3.ClH/c16-11-3-1-2-4-13(11)20-7-5-15(19)18-6-8-21-14-10-17-9-12(14)18;/h1-4,12,14,17H,5-10H2;1H/t12-,14+;/m1./s1 |
| InChIKey | BRKWYPKHYPZTHC-OJMBIDBESA-N |
| XLogP | 1.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |