C17H16FNO3 — CID 110740351
2-(2-fluorophenoxy)-1-(2-phenyl-1,3-oxazolidin-3-yl)ethanone (PubChem CID 110740351) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-1-(2-phenyl-1,3-oxazolidin-3-yl)ethanone.
| Compound Name | 2-(2-fluorophenoxy)-1-(2-phenyl-1,3-oxazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 110740351 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(2-fluorophenoxy)-1-(2-phenyl-1,3-oxazolidin-3-yl)ethanone |
| SMILES | O=C(COc1ccccc1F)N1CCOC1c1ccccc1 |
| InChI | InChI=1S/C17H16FNO3/c18-14-8-4-5-9-15(14)22-12-16(20)19-10-11-21-17(19)13-6-2-1-3-7-13/h1-9,17H,10-12H2 |
| InChIKey | ILRXDUSSQQHOEL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |