C18H16Cl2FNO3 — CID 97106593
1-[(2S)-2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(2-fluorophenoxy)ethanone (PubChem CID 97106593) has the molecular formula C18H16Cl2FNO3 and a molecular weight of 384.23 g/mol. Its IUPAC name is 1-[(2S)-2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(2-fluorophenoxy)ethanone.
| Compound Name | 1-[(2S)-2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(2-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 97106593 |
| Molecular Formula | C18H16Cl2FNO3 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-[(2S)-2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(2-fluorophenoxy)ethanone |
| SMILES | O=C(COc1ccccc1F)N1CCO[C@@H](c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C18H16Cl2FNO3/c19-13-7-12(8-14(20)9-13)17-10-22(5-6-24-17)18(23)11-25-16-4-2-1-3-15(16)21/h1-4,7-9,17H,5-6,10-11H2/t17-/m1/s1 |
| InChIKey | SCERYYBWRUSSKN-QGZVFWFLSA-N |
| XLogP | 4.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |