C20H21Cl2NO2 — CID 121134473
1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-4-phenylbutan-1-one (PubChem CID 121134473) has the molecular formula C20H21Cl2NO2 and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 121134473 |
| Molecular Formula | C20H21Cl2NO2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCOC(c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C20H21Cl2NO2/c21-17-11-16(12-18(22)13-17)19-14-23(9-10-25-19)20(24)8-4-7-15-5-2-1-3-6-15/h1-3,5-6,11-13,19H,4,7-10,14H2 |
| InChIKey | WBDQQQTYCFBXGJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |