C19H25Cl2NO2 — CID 121134464
3-cyclohexyl-1-[2-(3,5-dichlorophenyl)morpholin-4-yl]propan-1-one (PubChem CID 121134464) has the molecular formula C19H25Cl2NO2 and a molecular weight of 370.32 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(3,5-dichlorophenyl)morpholin-4-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[2-(3,5-dichlorophenyl)morpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 121134464 |
| Molecular Formula | C19H25Cl2NO2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-cyclohexyl-1-[2-(3,5-dichlorophenyl)morpholin-4-yl]propan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CCOC(c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C19H25Cl2NO2/c20-16-10-15(11-17(21)12-16)18-13-22(8-9-24-18)19(23)7-6-14-4-2-1-3-5-14/h10-12,14,18H,1-9,13H2 |
| InChIKey | UDJRELPHXGALJO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |