C20H21Cl2NO3 — CID 121134501
1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(4-ethoxyphenyl)ethanone (PubChem CID 121134501) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(4-ethoxyphenyl)ethanone.
| Compound Name | 1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 121134501 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)morpholin-4-yl]-2-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCOC(c3cc(Cl)cc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3/c1-2-25-18-5-3-14(4-6-18)9-20(24)23-7-8-26-19(13-23)15-10-16(21)12-17(22)11-15/h3-6,10-12,19H,2,7-9,13H2,1H3 |
| InChIKey | WJKVPBSOVYDDNA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |