C18H19Cl2NO3S — CID 121134610
2-(3,5-dichlorophenyl)-4-(2-phenylethylsulfonyl)morpholine (PubChem CID 121134610) has the molecular formula C18H19Cl2NO3S and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-4-(2-phenylethylsulfonyl)morpholine.
| Compound Name | 2-(3,5-dichlorophenyl)-4-(2-phenylethylsulfonyl)morpholine |
|---|---|
| PubChem CID | 121134610 |
| Molecular Formula | C18H19Cl2NO3S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-4-(2-phenylethylsulfonyl)morpholine |
| SMILES | O=S(=O)(CCc1ccccc1)N1CCOC(c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C18H19Cl2NO3S/c19-16-10-15(11-17(20)12-16)18-13-21(7-8-24-18)25(22,23)9-6-14-4-2-1-3-5-14/h1-5,10-12,18H,6-9,13H2 |
| InChIKey | WVAGYRCPMFHYLB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |